What is the molecular formula of Isodecyl benzoate?
The molecular formula of Isodecyl benzoate is C17H26O2.
What is the molecular weight of Isodecyl benzoate?
The molecular weight of Isodecyl benzoate is 262.4 g/mol.
What is the IUPAC name of Isodecyl benzoate?
The IUPAC name of Isodecyl benzoate is 8-methylnonyl benzoate.
What is the InChI of Isodecyl benzoate?
The InChI of Isodecyl benzoate is InChI=1S/C17H26O2/c1-15(2)11-7-4-3-5-10-14-19-17(18)16-12-8-6-9-13-16/h6,8-9,12-13,15H,3-5,7,10-11,14H2,1-2H3.
What is the InChIKey of Isodecyl benzoate?
The InChIKey of Isodecyl benzoate is HNDYULRADYGBDU-UHFFFAOYSA-N.
What is the canonical SMILES of Isodecyl benzoate?
The canonical SMILES of Isodecyl benzoate is CC(C)CCCCCCCOC(=O)C1=CC=CC=C1.
What is the CAS number of Isodecyl benzoate?
The CAS number of Isodecyl benzoate is 120657-54-7.
What is the XLogP3 value of Isodecyl benzoate?
The XLogP3 value of Isodecyl benzoate is 6.5.
What is the hydrogen bond donor count of Isodecyl benzoate?
The hydrogen bond donor count of Isodecyl benzoate is 0.
Is Isodecyl benzoate a canonicalized compound?
Yes, Isodecyl benzoate is a canonicalized compound according to PubChem.