What is the molecular formula of Isoacteoside?
The molecular formula of Isoacteoside is C29H36O15.
What is the molecular weight of Isoacteoside?
The molecular weight of Isoacteoside is 624.6 g/mol.
What is the IUPAC name of Isoacteoside?
The IUPAC name of Isoacteoside is [(2R,3R,4S,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
What is the InChI of Isoacteoside?
The InChI of Isoacteoside is InChI=1S/C29H36O15/c1-13-22(35)24(37)25(38)29(42-13)44-27-23(36)20(12-41-21(34)7-4-14-2-5-16(30)18(32)10-14)43-28(26(27)39)40-9-8-15-3-6-17(31)19(33)11-15/h2-7,10-11,13,20,22-33,35-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23+,24+,25+,26+,27-,28+,29-/m0/s1.
What is the InChIKey of Isoacteoside?
The InChIKey of Isoacteoside is FNMHEHXNBNCPCI-QEOJJFGVSA-N.
What is the canonical SMILES of Isoacteoside?
The canonical SMILES of Isoacteoside is CC1C(C(C(C(O1)OC2C(C(OC(C2O)OCCC3=CC(=C(C=C3)O)O)COC(=O)C=CC4=CC(=C(C=C4)O)O)O)O)O)O.
What is the CAS number of Isoacteoside?
The CAS number of Isoacteoside is 61303-13-7.
How many hydrogen bond donor counts does Isoacteoside have?
Isoacteoside has 9 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Isoacteoside have?
Isoacteoside has 15 hydrogen bond acceptor counts.