What is the molecular formula of iobitridol?
The molecular formula of iobitridol is C20H28I3N3O9.
What is the molecular weight of iobitridol?
The molecular weight of iobitridol is 835.2 g/mol.
What is the IUPAC name of iobitridol?
The IUPAC name of iobitridol is 1-N,3-N-bis(2,3-dihydroxypropyl)-5-[[3-hydroxy-2-(hydroxymethyl)propanoyl]amino]-2,4,6-triiodo-1-N,3-N-dimethylbenzene-1,3-dicarboxamide.
What is the InChI of iobitridol?
The InChI of iobitridol is InChI=1S/C20H28I3N3O9/c1-25(3-10(31)7-29)19(34)12-14(21)13(20(35)26(2)4-11(32)8-30)16(23)17(15(12)22)24-18(33)9(5-27)6-28/h9-11,27-32H,3-8H2,1-2H3,(H,24,33).
What is the InChIKey of iobitridol?
The InChIKey of iobitridol is YLPBXIKWXNRACS-UHFFFAOYSA-N.
What are the synonyms of iobitridol?
The synonyms of iobitridol are Xenetix, 182ECH14UH, and 1-N,3-N-bis(2,3-dihydroxypropyl)-5-[[3-hydroxy-2-(hydroxymethyl)propanoyl]amino]-2,4,6-triiodo-1-N,3-N-dimethylbenzene-1,3-dicarboxamide.
What is the role of iobitridol?
Iobitridol has a role as a xenobiotic, an environmental contaminant, and a radioopaque medium.
How is iobitridol used in trials?
Iobitridol has been used in trials studying the diagnostic of Diagnostic Imaging, Coronary Artery Disease, Type 2 Diabetes Mellitus, and Coronary Atherosclerosis.
What is the drug class of iobitridol?
Iobitridol is a water-soluble, tri-iodinated, non-ionic monomeric benzoate derivative and contrast medium used in diagnostic radiography.
How is iobitridol eliminated from the body?
Iobitridol is rapidly removed by the kidneys in an unchanged form, and in cases of renal failure, heterotropic excretion occurs via the biliary route.