What is the molecular formula of H-Tyr(Bzl)-oh?
The molecular formula of H-Tyr(Bzl)-oh is C16H17NO3.
What is the molecular weight of H-Tyr(Bzl)-oh?
The molecular weight of H-Tyr(Bzl)-oh is 271.31 g/mol.
What is the IUPAC name of H-Tyr(Bzl)-oh?
The IUPAC name of H-Tyr(Bzl)-oh is (2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoic acid.
What is the InChI of H-Tyr(Bzl)-oh?
The InChI of H-Tyr(Bzl)-oh is InChI=1S/C16H17NO3/c17-15(16(18)19)10-12-6-8-14(9-7-12)20-11-13-4-2-1-3-5-13/h1-9,15H,10-11,17H2,(H,18,19)/t15-/m0/s1.
What is the InChIKey of H-Tyr(Bzl)-oh?
The InChIKey of H-Tyr(Bzl)-oh is KAFHLONDOVSENM-HNNXBMFYSA-N.
What is the canonical SMILES of H-Tyr(Bzl)-oh?
The canonical SMILES of H-Tyr(Bzl)-oh is C1=CC=C(C=C1)COC2=CC=C(C=C2)CC(C(=O)O)N.
What is the CAS number of H-Tyr(Bzl)-oh?
The CAS number of H-Tyr(Bzl)-oh is 16652-64-5.
What is the XLogP3 value of H-Tyr(Bzl)-oh?
The XLogP3 value of H-Tyr(Bzl)-oh is -0.1.
What is the hydrogen bond donor count of H-Tyr(Bzl)-oh?
The hydrogen bond donor count of H-Tyr(Bzl)-oh is 2.