What is the PubChem CID for 16-Mercaptohexadecanoic acid?
PubChem CID: 3522585
What is the molecular formula of 16-Mercaptohexadecanoic acid?
Molecular Formula: C16H32O2S
What is the molecular weight of 16-Mercaptohexadecanoic acid?
Molecular Weight: 288.5 g/mol
What is the IUPAC name of 16-Mercaptohexadecanoic acid?
IUPAC Name: 16-sulfanylhexadecanoic acid
What is the InChI of 16-Mercaptohexadecanoic acid?
InChI: InChI=1S/C16H32O2S/c17-16(18)14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-19/h19H,1-15H2,(H,17,18)
What is the InChIKey of 16-Mercaptohexadecanoic acid?
InChIKey: INOAASCWQMFJQA-UHFFFAOYSA-N
What is the canonical SMILES of 16-Mercaptohexadecanoic acid?
Canonical SMILES: C(CCCCCCCC(=O)O)CCCCCCCS
What is the CAS number of 16-Mercaptohexadecanoic acid?
CAS number: 69839-68-5
What is the EC number of 16-Mercaptohexadecanoic acid?
EC number: 628-111-5
Is 16-Mercaptohexadecanoic acid a canonicalized compound?
Yes, it is a canonicalized compound.