What is the PubChem CID for Glycidyl cinnamate?
The PubChem CID for Glycidyl cinnamate is 53975804.
What is the molecular formula of Glycidyl cinnamate?
The molecular formula of Glycidyl cinnamate is C12H12O3.
What are the synonyms for Glycidyl cinnamate?
The synonyms for Glycidyl cinnamate are Glycidyl Cinnamate, 19532-86-6, and 2-Propenoic acid, 3-phenyl-, oxiranylmethyl ester.
What is the molecular weight of Glycidyl cinnamate?
The molecular weight of Glycidyl cinnamate is 204.22 g/mol.
What is the IUPAC name of Glycidyl cinnamate?
The IUPAC name of Glycidyl cinnamate is oxiran-2-ylmethyl 3-phenylprop-2-enoate.
What is the InChI code of Glycidyl cinnamate?
The InChI code of Glycidyl cinnamate is InChI=1S/C12H12O3/c13-12(15-9-11-8-14-11)7-6-10-4-2-1-3-5-10/h1-7,11H,8-9H2.
What is the InChIKey of Glycidyl cinnamate?
The InChIKey of Glycidyl cinnamate is JUVGLPRIQOJMIR-UHFFFAOYSA-N.
What is the canonical SMILES of Glycidyl cinnamate?
The canonical SMILES of Glycidyl cinnamate is C1C(O1)COC(=O)C=CC2=CC=CC=C2.
What is the XLogP3 value of Glycidyl cinnamate?
The XLogP3 value of Glycidyl cinnamate is 2.3.
Is Glycidyl cinnamate a canonicalized compound?
Yes, Glycidyl cinnamate is a canonicalized compound.