What is the molecular formula of glyceryl triacetate?
The molecular formula of glyceryl triacetate is C9H14O6.
What is the molecular weight of glyceryl triacetate?
The molecular weight of glyceryl triacetate is 218.20 g/mol.
What is the IUPAC name of glyceryl triacetate?
The IUPAC name of glyceryl triacetate is 2,3-diacetyloxypropyl acetate.
What is the InChIKey of glyceryl triacetate?
The InChIKey of glyceryl triacetate is URAYPUMNDPQOKB-UHFFFAOYSA-N.
What is the canonical SMILES of glyceryl triacetate?
The canonical SMILES of glyceryl triacetate is CC(=O)OCC(COC(=O)C)OC(=O)C.
What is the CAS number of glyceryl triacetate?
The CAS number of glyceryl triacetate is 102-76-1.
What is the UNII of glyceryl triacetate?
The UNII of glyceryl triacetate is XHX3C3X673.
What is the FEMA number of glyceryl triacetate?
The FEMA number of glyceryl triacetate is 2007.
What is the JECFA number of glyceryl triacetate?
The JECFA number of glyceryl triacetate is 920.
What is the KEGG ID of glyceryl triacetate?
The KEGG ID of glyceryl triacetate is D00384.