What is the molecular formula of Fmoc-his-oh?
The molecular formula of Fmoc-his-oh is C21H19N3O4.
How is Fmoc-his-oh represented in its canonical SMILES form?
Fmoc-his-oh is represented in its canonical SMILES form as C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CN=CN4)C(=O)O.
What is the IUPAC name of Fmoc-his-oh?
The IUPAC name of Fmoc-his-oh is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-imidazol-5-yl)propanoic acid.
What is the molecular weight of Fmoc-his-oh?
The molecular weight of Fmoc-his-oh is 377.4 g/mol.
How many hydrogen bond donor counts does Fmoc-his-oh have?
Fmoc-his-oh has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Fmoc-his-oh have?
Fmoc-his-oh has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does Fmoc-his-oh have?
Fmoc-his-oh has 7 rotatable bond counts.
What is the exact mass of Fmoc-his-oh?
The exact mass of Fmoc-his-oh is 377.13755610 g/mol.
What is the topological polar surface area of Fmoc-his-oh?
The topological polar surface area of Fmoc-his-oh is 104 ?2.
How many covalently-bonded unit counts does Fmoc-his-oh have?
Fmoc-his-oh has 1 covalently-bonded unit count.