What is the molecular formula of Fmoc-dopa(acetonide)-oh?
The molecular formula of Fmoc-dopa(acetonide)-oh is C27H25NO6.
What is the molecular weight of Fmoc-dopa(acetonide)-oh?
The molecular weight of Fmoc-dopa(acetonide)-oh is 459.5 g/mol.
What is the IUPAC Name of Fmoc-dopa(acetonide)-oh?
The IUPAC Name of Fmoc-dopa(acetonide)-oh is (2S)-3-(2,2-dimethyl-1,3-benzodioxol-5-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
What is the InChIKey of Fmoc-dopa(acetonide)-oh?
The InChIKey of Fmoc-dopa(acetonide)-oh is SHZLOTJPHMTVDI-QFIPXVFZSA-N.
What is the Canonical SMILES of Fmoc-dopa(acetonide)-oh?
The Canonical SMILES of Fmoc-dopa(acetonide)-oh is CC1(OC2=C(O1)C=C(C=C2)CC(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C.
What is the XLogP3-AA value for Fmoc-dopa(acetonide)-oh?
The XLogP3-AA value for Fmoc-dopa(acetonide)-oh is 5.1.
How many Hydrogen Bond Donor Counts does Fmoc-dopa(acetonide)-oh have?
Fmoc-dopa(acetonide)-oh has 2 Hydrogen Bond Donor Counts.
What is the Heavy Atom Count of Fmoc-dopa(acetonide)-oh?
The Heavy Atom Count of Fmoc-dopa(acetonide)-oh is 34.
Is the Compound Is Canonicalized for Fmoc-dopa(acetonide)-oh?
Yes, the Compound Is Canonicalized for Fmoc-dopa(acetonide)-oh.
What is the Formal Charge of Fmoc-dopa(acetonide)-oh?
The Formal Charge of Fmoc-dopa(acetonide)-oh is 0.