What is the molecular formula of Fmoc-D-lys-oh hcl?
The molecular formula of Fmoc-D-lys-oh hcl is C21H25ClN2O4.
What is the molecular weight of Fmoc-D-lys-oh hcl?
The molecular weight of Fmoc-D-lys-oh hcl is 404.9 g/mol.
What are some synonyms for Fmoc-D-lys-oh hcl?
Some synonyms for Fmoc-D-lys-oh hcl include 201002-47-3, N2-Fmoc-D-lysine Hydrochloride, and FMOC-D-LYS-OH HCL.
When was Fmoc-D-lys-oh hcl created and last modified?
Fmoc-D-lys-oh hcl was created on 2010-03-02 and last modified on 2023-12-30.
What is the IUPAC name of Fmoc-D-lys-oh hcl?
The IUPAC name of Fmoc-D-lys-oh hcl is (2R)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride.
What is the Canonical SMILES representation of Fmoc-D-lys-oh hcl?
The Canonical SMILES representation of Fmoc-D-lys-oh hcl is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCCCN)C(=O)O.Cl.
How many hydrogen bond donor counts are there in Fmoc-D-lys-oh hcl?
There are 4 hydrogen bond donor counts in Fmoc-D-lys-oh hcl.
What is the topological polar surface area of Fmoc-D-lys-oh hcl?
The topological polar surface area of Fmoc-D-lys-oh hcl is 102 ?2.
Does Fmoc-D-lys-oh hcl have any defined atom stereocenter counts?
Fmoc-D-lys-oh hcl has 1 defined atom stereocenter count.
Is Fmoc-D-lys-oh hcl a canonicalized compound?
Yes, Fmoc-D-lys-oh hcl is a canonicalized compound.