What is the molecular formula of Norfluoxetine hydrochloride?
The molecular formula of Norfluoxetine hydrochloride is C16H17ClF3NO.
What are the synonyms of Norfluoxetine hydrochloride?
The synonyms of Norfluoxetine hydrochloride include 57226-68-3, 3-Phenyl-3-(4-(trifluoromethyl)phenoxy)propan-1-amine hydrochloride, norfluoxetine hcl, and 3-Phenyl-3-(4-trifluoromethyl-phenoxy)-propylamine hydrochloride.
What is the molecular weight of Norfluoxetine hydrochloride?
The molecular weight of Norfluoxetine hydrochloride is 331.76 g/mol.
What is the IUPAC name of Norfluoxetine hydrochloride?
The IUPAC name of Norfluoxetine hydrochloride is 3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride.
What is the InChI of Norfluoxetine hydrochloride?
The InChI of Norfluoxetine hydrochloride is InChI=1S/C16H16F3NO.ClH/c17-16(18,19)13-6-8-14(9-7-13)21-15(10-11-20)12-4-2-1-3-5-12;/h1-9,15H,10-11,20H2;1H.
What is the InChIKey of Norfluoxetine hydrochloride?
The InChIKey of Norfluoxetine hydrochloride is GMTWWEPBGGXBTO-UHFFFAOYSA-N.
What is the Canonical SMILES of Norfluoxetine hydrochloride?
The Canonical SMILES of Norfluoxetine hydrochloride is C1=CC=C(C=C1)C(CCN)OC2=CC=C(C=C2)C(F)(F)F.Cl.
What is the CAS number of Norfluoxetine hydrochloride?
The CAS number of Norfluoxetine hydrochloride is 57226-68-3.
What is the hydrogen bond donor count of Norfluoxetine hydrochloride?
The hydrogen bond donor count of Norfluoxetine hydrochloride is 2.
What is the hydrogen bond acceptor count of Norfluoxetine hydrochloride?
The hydrogen bond acceptor count of Norfluoxetine hydrochloride is 5.
※ Please kindly note that our products are for research use only.