What is the molecular formula of Fluorescent Brightener 367?
The molecular formula of Fluorescent Brightener 367 is C24H14N2O2.
What are the synonyms for Fluorescent Brightener 367?
The synonyms for Fluorescent Brightener 367 are 5089-22-5, 1,4-Bis(benzo[d]oxazol-2-yl)naphthalene, and 1,4-Bis(2-benzoxazolyl)naphthalene.
What is the molecular weight of Fluorescent Brightener 367?
The molecular weight of Fluorescent Brightener 367 is 362.4 g/mol.
What is the IUPAC name of Fluorescent Brightener 367?
The IUPAC name of Fluorescent Brightener 367 is 2-[4-(1,3-benzoxazol-2-yl)naphthalen-1-yl]-1,3-benzoxazole.
What is the InChI of Fluorescent Brightener 367?
The InChI of Fluorescent Brightener 367 is InChI=1S/C24H14N2O2/c1-2-8-16-15(7-1)17(23-25-19-9-3-5-11-21(19)27-23)13-14-18(16)24-26-20-10-4-6-12-22(20)28-24/h1-14H.
What is the InChIKey of Fluorescent Brightener 367?
The InChIKey of Fluorescent Brightener 367 is WFYSPVCBIJCZPX-UHFFFAOYSA-N.
What is the Canonical SMILES of Fluorescent Brightener 367?
The Canonical SMILES of Fluorescent Brightener 367 is C1=CC=C2C(=C1)C(=CC=C2C3=NC4=CC=CC=C4O3)C5=NC6=CC=CC=C6O5.
What is the CAS number of Fluorescent Brightener 367?
The CAS number of Fluorescent Brightener 367 is 5089-22-5.
What is the XLogP3-AA value of Fluorescent Brightener 367?
The XLogP3-AA value of Fluorescent Brightener 367 is 6.2.
How many hydrogen bond acceptors does Fluorescent Brightener 367 have?
Fluorescent Brightener 367 has 4 hydrogen bond acceptors.
※ Please kindly note that our products are for research use only.