What is the molecular formula of floxuridine?
The molecular formula of floxuridine is C9H11FN2O5.
What is the molecular weight of floxuridine?
The molecular weight of floxuridine is 246.19 g/mol.
What is the IUPAC name of floxuridine?
The IUPAC name of floxuridine is 5-fluoro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
What is the InChIKey of floxuridine?
The InChIKey of floxuridine is ODKNJVUHOIMIIZ-RRKCRQDMSA-N.
What is the canonical SMILES of floxuridine?
The canonical SMILES of floxuridine is C1C(C(OC1N2C=C(C(=O)NC2=O)F)CO)O.
What is the CAS number of floxuridine?
The CAS number of floxuridine is 50-91-9.
What is the EC number of floxuridine?
The EC number of floxuridine is 200-072-5.
What is the UNII of floxuridine?
The UNII of floxuridine is 039LU44I5M.
What is the ChEMBL ID of floxuridine?
The ChEMBL ID of floxuridine is CHEMBL917.
What is the Wikipedia page for floxuridine?
The Wikipedia page for floxuridine is "Floxuridine".