What is the molecular formula of floctafenine?
The molecular formula of floctafenine is C20H17F3N2O4.
What is the molecular weight of floctafenine?
The molecular weight of floctafenine is 406.4 g/mol.
What is the IUPAC Name of floctafenine?
The IUPAC Name of floctafenine is 2,3-dihydroxypropyl 2-[[8-(trifluoromethyl)quinolin-4-yl]amino]benzoate.
What is the InChIKey of floctafenine?
The InChIKey of floctafenine is APQPGQGAWABJLN-UHFFFAOYSA-N.
What is the Canonical SMILES of floctafenine?
The Canonical SMILES of floctafenine is C1=CC=C(C(=C1)C(=O)OCC(CO)O)NC2=C3C=CC=C(C3=NC=C2)C(F)(F)F.
What is the CAS number of floctafenine?
The CAS number of floctafenine is 23779-99-9.
How many hydrogen bond donor counts does floctafenine have?
Floctafenine has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does floctafenine have?
Floctafenine has 9 hydrogen bond acceptor counts.
What is the topological polar surface area of floctafenine?
The topological polar surface area of floctafenine is 91.7 Å2.
How many rotatable bond counts does floctafenine have?
Floctafenine has 7 rotatable bond counts.