What is the molecular formula of Fenclorac?
The molecular formula of Fenclorac is C14H16Cl2O2.
When was Fenclorac created and last modified?
Fenclorac was created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC name of Fenclorac?
The IUPAC name of Fenclorac is 2-chloro-2-(3-chloro-4-cyclohexylphenyl)acetic acid.
What is the InChIKey of Fenclorac?
The InChIKey of Fenclorac is GXEUNRBWEAIPCN-UHFFFAOYSA-N.
What is the Canonical SMILES of Fenclorac?
The Canonical SMILES of Fenclorac is C1CCC(CC1)C2=C(C=C(C=C2)C(C(=O)O)Cl)Cl.
What is the molecular weight of Fenclorac?
The molecular weight of Fenclorac is 287.2 g/mol.
How many hydrogen bond donor counts does Fenclorac have?
Fenclorac has 1 hydrogen bond donor count.
What is the topological polar surface area of Fenclorac?
The topological polar surface area of Fenclorac is 37.3 Ų.
Does Fenclorac have any defined atom stereocenter counts?
Fenclorac has 0 defined atom stereocenter counts.
Is the compound of Fenclorac canonicalized?
Yes, the compound of Fenclorac is canonicalized.