What is the molecular formula of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride?
The molecular formula of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride is C8H6O4.
What is the molecular weight of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride?
The molecular weight of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride is 166.13 g/mol.
What is the IUPAC name of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride?
The IUPAC name of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride is 4,10-dioxatricyclo[5.2.1.0 2,6]dec-8-ene-3,5-dione.
What is the InChI of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride?
The InChI of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride is InChI=1S/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-6H.
What is the InChIKey of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride?
The InChIKey of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride is QQYNRBAAQFZCLF-UHFFFAOYSA-N.
What is the canonical SMILES of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride?
The canonical SMILES of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride is C1=CC2C3C(C1O2)C(=O)OC3=O.
What is the CAS number of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride?
The CAS number of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride is 5426-09-5.
What is the hydrogen bond donor count of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride?
The hydrogen bond donor count of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride is 0.
What is the hydrogen bond acceptor count of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride?
The hydrogen bond acceptor count of Exo-3,6-epoxy-1,2,-3,6-tetrahydrophthalic anhydride is 4.
What is the topological polar surface area of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride?
The topological polar surface area of Exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride is 52.6Ų.