What is the PubChem CID for exo-2-chloronorbornane?
The PubChem CID for exo-2-chloronorbornane is 12220913.
What is the molecular formula of exo-2-chloronorbornane?
The molecular formula of exo-2-chloronorbornane is C7H11Cl.
What is the molecular weight of exo-2-chloronorbornane?
The molecular weight of exo-2-chloronorbornane is 130.61 g/mol.
What is the IUPAC name of exo-2-chloronorbornane?
The IUPAC name of exo-2-chloronorbornane is (1S,4R)-2-chlorobicyclo[2.2.1]heptane.
What is the InChI of exo-2-chloronorbornane?
The InChI of exo-2-chloronorbornane is InChI=1S/C7H11Cl/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7?/m1/s1.
What is the InChIKey of exo-2-chloronorbornane?
The InChIKey of exo-2-chloronorbornane is PJWBUKHIZPKRJF-JEAXJGTLSA-N.
What is the canonical SMILES of exo-2-chloronorbornane?
The canonical SMILES of exo-2-chloronorbornane is C1CC2CC1CC2Cl.
What is the CAS number of exo-2-chloronorbornane?
The CAS number of exo-2-chloronorbornane is 765-91-3.
What is the European Community (EC) Number of exo-2-chloronorbornane?
The European Community (EC) Number of exo-2-chloronorbornane is 624-578-4.
Is exo-2-chloronorbornane a canonicalized compound?
Yes, exo-2-chloronorbornane is a canonicalized compound.