What is the PubChem CID of Etocrilene?
The PubChem CID of Etocrilene is 243274.
What is the molecular formula of Etocrilene?
The molecular formula of Etocrilene is C18H15NO2.
What are some synonyms of Etocrilene?
Some synonyms of Etocrilene are Ethyl 2-cyano-3,3-diphenylacrylate, Etocrylene, and UV Absorber-2.
What is the molecular weight of Etocrilene?
The molecular weight of Etocrilene is 277.3 g/mol.
What is the IUPAC name of Etocrilene?
The IUPAC name of Etocrilene is ethyl 2-cyano-3,3-diphenylprop-2-enoate.
What is the Canonical SMILES of Etocrilene?
The Canonical SMILES of Etocrilene is CCOC(=O)C(=C(C1=CC=CC=C1)C2=CC=CC=C2)C#N.
What is the CAS number of Etocrilene?
The CAS number of Etocrilene is 5232-99-5.
What is the UNII of Etocrilene?
The UNII of Etocrilene is 974109G71I.
What is the XLogP3-AA value of Etocrilene?
The XLogP3-AA value of Etocrilene is 4.4.
What is the topological polar surface area of Etocrilene?
The topological polar surface area of Etocrilene is 50.1Ų.