What is the molecular formula of ethyl violet?
The molecular formula of ethyl violet is C31H42ClN3.
What is the molecular weight of ethyl violet?
The molecular weight of ethyl violet is 492.1 g/mol.
What is the IUPAC name of ethyl violet?
The IUPAC name of ethyl violet is [4-[bis[4-(diethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium;chloride.
What is the InChI key of ethyl violet?
The InChI key of ethyl violet is JVICFMRAVNKDOE-UHFFFAOYSA-M.
What is the canonical SMILES of ethyl violet?
The canonical SMILES of ethyl violet is CCN(CC)C1=CC=C(C=C1)C(=C2C=CC(=[N+](CC)CC)C=C2)C3=CC=C(C=C3)N(CC)CC.[Cl-].
What is the CAS number of ethyl violet?
The CAS number of ethyl violet is 2390-59-2.
How many hydrogen bond donor counts does ethyl violet have?
Ethyl violet does not have any hydrogen bond donor counts.
How many hydrogen bond acceptor counts does ethyl violet have?
Ethyl violet has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does ethyl violet have?
Ethyl violet has 10 rotatable bond counts.
What is the topological polar surface area of ethyl violet?
The topological polar surface area of ethyl violet is 9.5 ?2.