What is the molecular formula of Ethyl isobutyrylacetate?
The molecular formula of Ethyl isobutyrylacetate is C8H14O3.
What is the molecular weight of Ethyl isobutyrylacetate?
The molecular weight of Ethyl isobutyrylacetate is 158.19 g/mol.
What is the IUPAC name of Ethyl isobutyrylacetate?
The IUPAC name of Ethyl isobutyrylacetate is ethyl 4-methyl-3-oxopentanoate.
What is the InChI of Ethyl isobutyrylacetate?
The InChI of Ethyl isobutyrylacetate is InChI=1S/C8H14O3/c1-4-11-8(10)5-7(9)6(2)3/h6H,4-5H2,1-3H3.
What is the InChIKey of Ethyl isobutyrylacetate?
The InChIKey of Ethyl isobutyrylacetate is XCLDSQRVMMXWMS-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl isobutyrylacetate?
The canonical SMILES of Ethyl isobutyrylacetate is CCOC(=O)CC(=O)C(C)C.
What is the CAS number of Ethyl isobutyrylacetate?
The CAS number of Ethyl isobutyrylacetate is 7152-15-0.
What is the EC number of Ethyl isobutyrylacetate?
The EC number of Ethyl isobutyrylacetate is 230-491-9.
What is the UNII of Ethyl isobutyrylacetate?
The UNII of Ethyl isobutyrylacetate is M3WMK56MNB.
Is Ethyl isobutyrylacetate a canonicalized compound?
Yes, Ethyl isobutyrylacetate is a canonicalized compound.