What is the molecular formula of Ethyl azidoacetate?
The molecular formula of Ethyl azidoacetate is C4H7N3O2.
What is the IUPAC name of Ethyl azidoacetate?
The IUPAC name of Ethyl azidoacetate is ethyl 2-azidoacetate.
What is the InChI of Ethyl azidoacetate?
The InChI of Ethyl azidoacetate is InChI=1S/C4H7N3O2/c1-2-9-4(8)3-6-7-5/h2-3H2,1H3.
What is the InChIKey of Ethyl azidoacetate?
The InChIKey of Ethyl azidoacetate is HVJJYOAPXBPQQV-UHFFFAOYSA-N.
What is the CAS number of Ethyl azidoacetate?
The CAS number of Ethyl azidoacetate is 637-81-0.
What is the molecular weight of Ethyl azidoacetate?
The molecular weight of Ethyl azidoacetate is 129.12 g/mol.
What is the XLogP3-AA value of Ethyl azidoacetate?
The XLogP3-AA value of Ethyl azidoacetate is 1.6.
How many hydrogen bond donor counts does Ethyl azidoacetate have?
Ethyl azidoacetate has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Ethyl azidoacetate have?
Ethyl azidoacetate has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Ethyl azidoacetate have?
Ethyl azidoacetate has 4 rotatable bond counts.