What is the molecular formula of Ethyl 4-bromobenzoate?
The molecular formula of Ethyl 4-bromobenzoate is C9H9BrO2.
What is the molecular weight of Ethyl 4-bromobenzoate?
The molecular weight of Ethyl 4-bromobenzoate is 229.07 g/mol.
What is the IUPAC name of Ethyl 4-bromobenzoate?
The IUPAC name of Ethyl 4-bromobenzoate is ethyl 4-bromobenzoate.
What is the InChI of Ethyl 4-bromobenzoate?
The InChI of Ethyl 4-bromobenzoate is InChI=1S/C9H9BrO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3.
What is the InChIKey of Ethyl 4-bromobenzoate?
The InChIKey of Ethyl 4-bromobenzoate is XZIAFENWXIQIKR-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 4-bromobenzoate?
The canonical SMILES of Ethyl 4-bromobenzoate is CCOC(=O)C1=CC=C(C=C1)Br.
What is the CAS number of Ethyl 4-bromobenzoate?
The CAS number of Ethyl 4-bromobenzoate is 5798-75-4.
What is the European Community (EC) number of Ethyl 4-bromobenzoate?
The European Community (EC) number of Ethyl 4-bromobenzoate is 227-347-2.
What is the UNII of Ethyl 4-bromobenzoate?
The UNII of Ethyl 4-bromobenzoate is 58G35541Q1.
Is Ethyl 4-bromobenzoate a canonicalized compound?
Yes, Ethyl 4-bromobenzoate is a canonicalized compound according to PubChem.