What is the molecular formula of Ethyl 2-bromobenzoate?
The molecular formula of Ethyl 2-bromobenzoate is C9H9BrO2.
What is the molecular weight of Ethyl 2-bromobenzoate?
The molecular weight of Ethyl 2-bromobenzoate is 229.07 g/mol.
What is the IUPAC name of Ethyl 2-bromobenzoate?
The IUPAC name of Ethyl 2-bromobenzoate is ethyl 2-bromobenzoate.
What is the InChI of Ethyl 2-bromobenzoate?
The InChI of Ethyl 2-bromobenzoate is InChI=1S/C9H9BrO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3.
What is the InChIKey of Ethyl 2-bromobenzoate?
The InChIKey of Ethyl 2-bromobenzoate is BIHHBTVQFPVSTE-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 2-bromobenzoate?
The canonical SMILES of Ethyl 2-bromobenzoate is CCOC(=O)C1=CC=CC=C1Br.
What is the CAS number of Ethyl 2-bromobenzoate?
The CAS number of Ethyl 2-bromobenzoate is 6091-64-1.
What is the European Community (EC) number of Ethyl 2-bromobenzoate?
The European Community (EC) number of Ethyl 2-bromobenzoate is 228-034-3.
Is Ethyl 2-bromobenzoate a canonicalized compound?
Yes, Ethyl 2-bromobenzoate is a canonicalized compound.