What is the molecular formula of Ethyl (2-bromo-5-fluorobenzoyl)acetate?
The molecular formula of Ethyl (2-bromo-5-fluorobenzoyl)acetate is C11H10BrFO3.
What are the synonyms of Ethyl (2-bromo-5-fluorobenzoyl)acetate?
The synonyms of Ethyl (2-bromo-5-fluorobenzoyl)acetate are ethyl 3-(2-bromo-5-fluorophenyl)-3-oxopropanoate, Benzenepropanoic acid, 2-bromo-5-fluoro-beta-oxo-, ethyl ester, and DTXSID50672276.
What is the molecular weight of Ethyl (2-bromo-5-fluorobenzoyl)acetate?
The molecular weight of Ethyl (2-bromo-5-fluorobenzoyl)acetate is 289.10 g/mol.
What is the IUPAC name of Ethyl (2-bromo-5-fluorobenzoyl)acetate?
The IUPAC name of Ethyl (2-bromo-5-fluorobenzoyl)acetate is ethyl 3-(2-bromo-5-fluorophenyl)-3-oxopropanoate.
What is the InChI of Ethyl (2-bromo-5-fluorobenzoyl)acetate?
The InChI of Ethyl (2-bromo-5-fluorobenzoyl)acetate is InChI=1S/C11H10BrFO3/c1-2-16-11(15)6-10(14)8-5-7(13)3-4-9(8)12/h3-5H,2,6H2,1H3.
What is the InChIKey of Ethyl (2-bromo-5-fluorobenzoyl)acetate?
The InChIKey of Ethyl (2-bromo-5-fluorobenzoyl)acetate is CLHWFHWYVGINKD-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl (2-bromo-5-fluorobenzoyl)acetate?
The canonical SMILES of Ethyl (2-bromo-5-fluorobenzoyl)acetate is CCOC(=O)CC(=O)C1=C(C=CC(=C1)F)Br.
What is the CAS number of Ethyl (2-bromo-5-fluorobenzoyl)acetate?
The CAS number of Ethyl (2-bromo-5-fluorobenzoyl)acetate is 1020058-49-4.
What is the European Community (EC) number of Ethyl (2-bromo-5-fluorobenzoyl)acetate?
The European Community (EC) number of Ethyl (2-bromo-5-fluorobenzoyl)acetate is 693-284-6.
※ Please kindly note that our products are for research use only.