What is the PubChem CID of Erio Green B?
The PubChem CID of Erio Green B is 160685.
What is the molecular formula of Erio Green B?
The molecular formula of Erio Green B is C31H33N2NaO6S2.
What are the synonyms of Erio Green B?
The synonyms of Erio Green B are Acid green 16, 12768-78-4, Lissamine Green V, and 3369-56-0.
What is the molecular weight of Erio Green B?
The molecular weight of Erio Green B is 616.7 g/mol.
What is the IUPAC name of Erio Green B?
The IUPAC name of Erio Green B is sodium;4-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]naphthalene-2,7-disulfonate.
What is the InChI of Erio Green B?
The InChI of Erio Green B is InChI=1S/C31H34N2O6S2.Na/c1-5-32(6-2)25-13-9-22(10-14-25)31(23-11-15-26(16-12-23)33(7-3)8-4)30-21-28(41(37,38)39)20-24-19-27(40(34,35)36)17-18-29(24)30;/h9-21H,5-8H2,1-4H3,(H-,34,35,36,37,38,39);/q;+1/p-1.
What is the InChIKey of Erio Green B?
The InChIKey of Erio Green B is UWGCNDBLFSEBDW-UHFFFAOYSA-M.
What is the canonical SMILES of Erio Green B?
The canonical SMILES of Erio Green B is CCN(CC)C1=CC=C(C=C1)C(=C2C=CC(=[N+](CC)CC)C=C2)C3=C4C=CC(=CC4=CC(=C3)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].
What is the CAS number of Erio Green B?
The CAS number of Erio Green B is 3369-56-0.