What is the molecular formula of Equisetin?
The molecular formula of Equisetin is C22H31NO4.
What are some synonyms of Equisetin?
Some synonyms of Equisetin are (-)-Equisetin and V56ZMM5VMZ.
What is the molecular weight of Equisetin?
The molecular weight of Equisetin is 373.5 g/mol.
When was Equisetin created and modified?
Equisetin was created on December 26, 2011, and modified on December 30, 2023.
Where is Equisetin found?
Equisetin is found in Saccharopolyspora erythraea, Ferula equisetacea, and other organisms.
What is the IUPAC Name of Equisetin?
The IUPAC Name of Equisetin is (3E,5S)-3-[[(1S,2R,4aS,6R,8aR)-1,6-dimethyl-2-[(E)-prop-1-enyl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-hydroxymethylidene]-5-(hydroxymethyl)-1-methylpyrrolidine-2,4-dione.
What is the InChI of Equisetin?
The InChI of Equisetin is InChI=1S/C22H31NO4/c1-5-6-15-9-8-14-11-13(2)7-10-16(14)22(15,3)20(26)18-19(25)17(12-24)23(4)21(18)27/h5-6,8-9,13-17,24,26H,7,10-12H2,1-4H3/b6-5+,20-18+/t13-,14-,15-,16-,17+,22-/m1/s1.
What is the InChIKey of Equisetin?
The InChIKey of Equisetin is QNQBPPQLRODXET-AIMHRHHOSA-N.
What is the Canonical SMILES of Equisetin?
The Canonical SMILES of Equisetin is CC=CC1C=CC2CC(CCC2C1(C)C(=C3C(=O)C(N(C3=O)C)CO)O)C.
What is the UNII of Equisetin?
The UNII of Equisetin is V56ZMM5VMZ.