What is the PubChem CID for Eltenac?
The PubChem CID for Eltenac is 51717.
What is the molecular formula of Eltenac?
The molecular formula of Eltenac is C12H9Cl2NO2S.
What is the molecular weight of Eltenac?
The molecular weight of Eltenac is 302.2 g/mol.
What is the IUPAC name of Eltenac?
The IUPAC name of Eltenac is 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetic acid.
What is the InChI of Eltenac?
The InChI of Eltenac is InChI=1S/C12H9Cl2NO2S/c13-8-2-1-3-9(14)12(8)15-10-6-18-5-7(10)4-11(16)17/h1-3,5-6,15H,4H2,(H,16,17).
What is the InChIKey of Eltenac?
The InChIKey of Eltenac is AELILMBZWCGOSB-UHFFFAOYSA-N.
What is the canonical SMILES of Eltenac?
The canonical SMILES of Eltenac is C1=CC(=C(C(=C1)Cl)NC2=CSC=C2CC(=O)O).
What is the CAS number of Eltenac?
The CAS number of Eltenac is 72895-88-6.
What is the European Community (EC) number of Eltenac?
The European Community (EC) number of Eltenac is 688-480-3.
What is the PubChem computed XLogP3-AA value for Eltenac?
The PubChem computed XLogP3-AA value for Eltenac is 3.9.