What is the molecular formula of E-7-Dodecenyl acetate?
The molecular formula of E-7-Dodecenyl acetate is C14H26O2.
What is the molecular weight of E-7-Dodecenyl acetate?
The molecular weight of E-7-Dodecenyl acetate is 226.35 g/mol.
What is the IUPAC name of E-7-Dodecenyl acetate?
The IUPAC name of E-7-Dodecenyl acetate is [(E)-dodec-7-enyl] acetate.
What is the InChI of E-7-Dodecenyl acetate?
The InChI of E-7-Dodecenyl acetate is InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h6-7H,3-5,8-13H2,1-2H3/b7-6+.
What is the InChIKey of E-7-Dodecenyl acetate?
The InChIKey of E-7-Dodecenyl acetate is MUZGQHWTRUVFLG-VOTSOKGWSA-N.
What is the canonical SMILES of E-7-Dodecenyl acetate?
The canonical SMILES of E-7-Dodecenyl acetate is CCCCC=CCCCCCCOC(=O)C.
How many hydrogen bond donor count does E-7-Dodecenyl acetate have?
E-7-Dodecenyl acetate has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does E-7-Dodecenyl acetate have?
E-7-Dodecenyl acetate has 2 hydrogen bond acceptor count.
How many rotatable bond count does E-7-Dodecenyl acetate have?
E-7-Dodecenyl acetate has 11 rotatable bond count.
What is the topological polar surface area of E-7-Dodecenyl acetate?
The topological polar surface area of E-7-Dodecenyl acetate is 26.3 ?2.