What is the molecular formula of (E)-3-(5-Nitro-2-furyl)acrylaldehyde?
The molecular formula is C7H5NO4.
What are the synonyms of (E)-3-(5-Nitro-2-furyl)acrylaldehyde?
The synonyms include 1874-22-2, 52661-56-0, (E)-3-(5-Nitrofuran-2-yl)acrylaldehyde, 5-Nitrofuran-2-acrylaldehyde, and 3-(5-Nitro-2-furyl)acrolein.
What is the molecular weight of (E)-3-(5-Nitro-2-furyl)acrylaldehyde?
The molecular weight is 167.12 g/mol.
What is the IUPAC name of (E)-3-(5-Nitro-2-furyl)acrylaldehyde?
The IUPAC name is (E)-3-(5-nitrofuran-2-yl)prop-2-enal.
What is the InChI of (E)-3-(5-Nitro-2-furyl)acrylaldehyde?
The InChI is InChI=1S/C7H5NO4/c9-5-1-2-6-3-4-7(12-6)8(10)11/h1-5H/b2-1+.
What is the InChIKey of (E)-3-(5-Nitro-2-furyl)acrylaldehyde?
The InChIKey is DXWCZMGIIFEEPU-OWOJBTEDSA-N.
What is the canonical SMILES of (E)-3-(5-Nitro-2-furyl)acrylaldehyde?
The canonical SMILES is C1=C(OC(=C1)[N+](=O)[O-])C=CC=O.
What is the CAS number of (E)-3-(5-Nitro-2-furyl)acrylaldehyde?
The CAS numbers are 52661-56-0 and 1874-22-2.
What are some computed properties of (E)-3-(5-Nitro-2-furyl)acrylaldehyde?
Some computed properties include molecular weight, XLogP3, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, and undefined bond stereocenter count.
※ Please kindly note that our products are for research use only.