What is the molecular formula of Dracorhodin perochlorate?
The molecular formula of Dracorhodin perochlorate is C17H15ClO7.
What is the molecular weight of Dracorhodin perochlorate?
The molecular weight of Dracorhodin perochlorate is 366.7 g/mol.
What is the IUPAC Name of Dracorhodin perochlorate?
The IUPAC Name of Dracorhodin perochlorate is 5-methoxy-6-methyl-2-phenylchromenylium-7-ol;perchlorate.
What is the InChI of Dracorhodin perochlorate?
The InChI of Dracorhodin perochlorate is InChI=1S/C17H14O3.ClHO4/c1-11-14(18)10-16-13(17(11)19-2)8-9-15(20-16)12-6-4-3-5-7-12;2-1(3,4)5/h3-10H,1-2H3;(H,2,3,4,5).
What is the InChIKey of Dracorhodin perochlorate?
The InChIKey of Dracorhodin perochlorate is KRTYZFUODYMZPG-UHFFFAOYSA-N.
What is the canonical SMILES of Dracorhodin perochlorate?
The canonical SMILES of Dracorhodin perochlorate is CC1=C(C2=C(C=C1O)[O+]=C(C=C2)C3=CC=CC=C3)OC.[O-]Cl(=O)(=O)=O.
What is the hydrogen bond donor count of Dracorhodin perochlorate?
The hydrogen bond donor count of Dracorhodin perochlorate is 1.
What is the hydrogen bond acceptor count of Dracorhodin perochlorate?
The hydrogen bond acceptor count of Dracorhodin perochlorate is 6.
How many rotatable bonds are there in Dracorhodin perochlorate?
There are 2 rotatable bonds in Dracorhodin perochlorate.
What is the topological polar surface area of Dracorhodin perochlorate?
The topological polar surface area of Dracorhodin perochlorate is 105?2.