What is the molecular formula of Dodecylbenzyl chloride?
The molecular formula of Dodecylbenzyl chloride is C19H31Cl.
What is the molecular weight of Dodecylbenzyl chloride?
The molecular weight of Dodecylbenzyl chloride is 294.9 g/mol.
What is the IUPAC Name of Dodecylbenzyl chloride?
The IUPAC Name of Dodecylbenzyl chloride is 1-chlorotridecylbenzene.
What is the InChI of Dodecylbenzyl chloride?
The InChI of Dodecylbenzyl chloride is InChI=1S/C19H31Cl/c1-2-3-4-5-6-7-8-9-10-14-17-19(20)18-15-12-11-13-16-18/h11-13,15-16,19H,2-10,14,17H2,1H3.
What is the InChIKey of Dodecylbenzyl chloride?
The InChIKey of Dodecylbenzyl chloride is ISXDOPCKEDRLAY-UHFFFAOYSA-N.
What is the Canonical SMILES of Dodecylbenzyl chloride?
The Canonical SMILES of Dodecylbenzyl chloride is CCCCCCCCCCCC(C1=CC=CC=C1)Cl.
What is the CAS number of Dodecylbenzyl chloride?
The CAS number of Dodecylbenzyl chloride is 28061-21-4.
What is the European Community (EC) Number of Dodecylbenzyl chloride?
The European Community (EC) Number of Dodecylbenzyl chloride is 248-810-5.
What is the XLogP3-AA value of Dodecylbenzyl chloride?
The XLogP3-AA value of Dodecylbenzyl chloride is 8.5.
Is Dodecylbenzyl chloride a canonicalized compound?
Yes, Dodecylbenzyl chloride is a canonicalized compound.