What is the molecular formula of dodecenylsuccinic acid?
The molecular formula of dodecenylsuccinic acid is C16H28O4.
What are the synonyms of dodecenylsuccinic acid?
The synonyms of dodecenylsuccinic acid are Butanedioic acid, dodecenyl- and Dodecenyl succinate.
What is the molecular weight of dodecenylsuccinic acid?
The molecular weight of dodecenylsuccinic acid is 284.39 g/mol.
When was dodecenylsuccinic acid created?
Dodecenylsuccinic acid was created on August 8, 2005.
What is the IUPAC name of dodecenylsuccinic acid?
The IUPAC name of dodecenylsuccinic acid is 2-[(E)-dodec-1-enyl]butanedioic acid.
What is the InChI of dodecenylsuccinic acid?
The InChI of dodecenylsuccinic acid is InChI=1S/C16H28O4/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20)/b12-11+.
What is the CAS number of dodecenylsuccinic acid?
The CAS number of dodecenylsuccinic acid is 29658-97-7.
What is the EC number of dodecenylsuccinic acid?
The EC number of dodecenylsuccinic acid is 249-757-0.
What is the XLogP3-AA value of dodecenylsuccinic acid?
The XLogP3-AA value of dodecenylsuccinic acid is 5.1.
What is the physical description of dodecenylsuccinic acid?
Dodecenylsuccinic acid is a liquid.