What is the molecular formula of DL-alaninol?
The molecular formula of DL-alaninol is C3H9NO.
What is the molecular weight of DL-alaninol?
The molecular weight of DL-alaninol is 75.11 g/mol.
What are the synonyms of DL-alaninol?
The synonyms of DL-alaninol are 2-Aminopropan-1-ol and 2-Amino-1-propanol.
What is the IUPAC name of DL-alaninol?
The IUPAC name of DL-alaninol is 2-aminopropan-1-ol.
What is the InChI of DL-alaninol?
The InChI of DL-alaninol is "InChI=1S/C3H9NO/c1-3(4)2-5/h3,5H,2,4H2,1H3".
Is DL-alaninol toxic?
DL-alaninol is moderately toxic by ingestion and skin contact, and it is also a severe skin irritant.
What is the UN number of DL-alaninol?
The UN number of DL-alaninol is 2735.
Is DL-alaninol combustible?
Yes, DL-alaninol is combustible.
What are the computed properties of DL-alaninol?
The computed properties of DL-alaninol include molecular weight, XLogP3-AA, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, and monoisotopic mass.
Can DL-alaninol float and mix with water?
Yes, DL-alaninol can float and mix with water.