What is the molecular formula of Disperse Violet 33?
The molecular formula of Disperse Violet 33 is C18H19N5O4.
What is the molecular weight of Disperse Violet 33?
The molecular weight of Disperse Violet 33 is 369.4 g/mol.
What is the IUPAC name of Disperse Violet 33?
The IUPAC name of Disperse Violet 33 is 2-[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]diazenyl]-5-nitrobenzonitrile.
What is the InChI of Disperse Violet 33?
The InChI of Disperse Violet 33 is InChI=1S/C18H19N5O4/c1-13-10-15(22(6-8-24)7-9-25)2-4-17(13)20-21-18-5-3-16(23(26)27)11-14(18)12-19/h2-5,10-11,24-25H,6-9H2,1H3.
What is the InChIKey of Disperse Violet 33?
The InChIKey of Disperse Violet 33 is SAEOXNIKTXFZNK-UHFFFAOYSA-N.
What is the canonical SMILES of Disperse Violet 33?
The canonical SMILES of Disperse Violet 33 is CC1=C(C=CC(=C1)N(CCO)CCO)N=NC2=C(C=C(C=C2)[N+](=O)[O-])C#N.
What is the CAS number of Disperse Violet 33?
The CAS number of Disperse Violet 33 is 113202-90-7.
What is the EC number of Disperse Violet 33?
The EC number of Disperse Violet 33 is 235-460-3.
What is the XLogP3-AA value of Disperse Violet 33?
The XLogP3-AA value of Disperse Violet 33 is 2.4.
Is Disperse Violet 33 a canonicalized compound?
Yes, Disperse Violet 33 is a canonicalized compound.