What is the molecular formula of Disperse Violet 17?
The molecular formula of Disperse Violet 17 is C14H8BrNO3.
What is the molecular weight of Disperse Violet 17?
The molecular weight of Disperse Violet 17 is 318.12 g/mol.
What is the IUPAC name of Disperse Violet 17?
The IUPAC name of Disperse Violet 17 is 1-amino-2-bromo-4-hydroxyanthracene-9,10-dione.
What is the InChI of Disperse Violet 17?
The InChI of Disperse Violet 17 is InChI=1S/C14H8BrNO3/c15-8-5-9(17)10-11(12(8)16)14(19)7-4-2-1-3-6(7)13(10)18/h1-5,17H,16H2.
What is the InChIKey of Disperse Violet 17?
The InChIKey of Disperse Violet 17 is MSSQDESMUMSQEN-UHFFFAOYSA-N.
What is the canonical SMILES of Disperse Violet 17?
The canonical SMILES of Disperse Violet 17 is C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3O)Br)N.
What is the CAS number of Disperse Violet 17?
The CAS number of Disperse Violet 17 is 116-82-5.
What is the XLogP3-AA value of Disperse Violet 17?
The XLogP3-AA value of Disperse Violet 17 is 3.6.
How many hydrogen bond donor counts does Disperse Violet 17 have?
Disperse Violet 17 has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Disperse Violet 17 have?
Disperse Violet 17 has 4 hydrogen bond acceptor counts.