What is the molecular formula of Disperse Red 97?
The molecular formula of Disperse Red 97 is C17H16N6O5.
When was the structure of Disperse Red 97 created and modified?
The structure of Disperse Red 97 was created on 2005-08-08 and modified on 2023-12-23.
What is the molecular weight of Disperse Red 97?
The molecular weight of Disperse Red 97 is 384.3 g/mol.
What is the IUPAC Name of Disperse Red 97?
The IUPAC Name of Disperse Red 97 is 3-[4-[(2,4-dinitrophenyl)diazenyl]-N-(2-hydroxyethyl)anilino]propanenitrile.
What is the Canonical SMILES of Disperse Red 97?
The Canonical SMILES of Disperse Red 97 is C1=CC(=CC=C1N=NC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-])N(CCC#N)CCO.
What is the CAS number of Disperse Red 97?
The CAS number of Disperse Red 97 is 81367-85-3.
What is the XLogP3-AA value of Disperse Red 97?
The XLogP3-AA value of Disperse Red 97 is 2.5.
How many hydrogen bond acceptor counts are there in Disperse Red 97?
There are 9 hydrogen bond acceptor counts in Disperse Red 97.
What is the heavy atom count of Disperse Red 97?
The heavy atom count of Disperse Red 97 is 28.
Is the compound of Disperse Red 97 canonicalized?
Yes, the compound of Disperse Red 97 is canonicalized.