What is the PubChem CID for Disperse Red 86?
The PubChem CID for Disperse Red 86 is 66486.
What is the molecular formula of Disperse Red 86?
The molecular formula of Disperse Red 86 is C22H18N2O5S.
What is the molecular weight of Disperse Red 86?
The molecular weight of Disperse Red 86 is 422.5 g/mol.
What is the IUPAC name of Disperse Red 86?
The IUPAC name of Disperse Red 86 is N-(4-amino-3-methoxy-9,10-dioxoanthracen-1-yl)-4-methylbenzenesulfonamide.
What is the InChI of Disperse Red 86?
The InChI of Disperse Red 86 is InChI=1S/C22H18N2O5S/c1-12-7-9-13(10-8-12)30(27,28)24-16-11-17(29-2)20(23)19-18(16)21(25)14-5-3-4-6-15(14)22(19)26/h3-11,24H,23H2,1-2H3.
What is the InChIKey of Disperse Red 86?
The InChIKey of Disperse Red 86 is BXIGAWRFDMDLTL-UHFFFAOYSA-N.
What is the Canonical SMILES of Disperse Red 86?
The Canonical SMILES of Disperse Red 86 is CC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C3=C2C(=O)C4=CC=CC=C4C3=O)N)OC.
What is the CAS number of Disperse Red 86?
The CAS number of Disperse Red 86 is 81-68-5.
What is the UNII of Disperse Red 86?
The UNII of Disperse Red 86 is 09YGU3071S.
What is the molecular weight of Disperse Red 86 computed by PubChem?
The molecular weight of Disperse Red 86 computed by PubChem is 422.5 g/mol.