What is the molecular formula of Disperse Red 65?
The molecular formula of Disperse Red 65 is C18H18ClN5O2.
What is the molecular weight of Disperse Red 65?
The molecular weight of Disperse Red 65 is 371.8 g/mol.
What is the IUPAC name of Disperse Red 65?
The IUPAC name of Disperse Red 65 is 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethyl-3-methylanilino]propanenitrile.
What is the InChI of Disperse Red 65?
The InChI of Disperse Red 65 is InChI=1S/C18H18ClN5O2/c1-3-23(10-4-9-20)14-5-7-17(13(2)11-14)21-22-18-8-6-15(24(25)26)12-16(18)19/h5-8,11-12H,3-4,10H2,1-2H3.
What is the InChIKey of Disperse Red 65?
The InChIKey of Disperse Red 65 is BHOOSPBGGKYHCM-UHFFFAOYSA-N.
What is the Canonical SMILES of Disperse Red 65?
The Canonical SMILES of Disperse Red 65 is CCN(CCC#N)C1=CC(=C(C=C1)N=NC2=C(C=C(C=C2)[N+](=O)[O-])Cl)C.
What is the CAS number of Disperse Red 65?
The CAS number of Disperse Red 65 is 16586-43-9.
What is the XLogP3-AA value of Disperse Red 65?
The XLogP3-AA value of Disperse Red 65 is 4.7.
How many hydrogen bond acceptor counts does Disperse Red 65 have?
Disperse Red 65 has 6 hydrogen bond acceptor counts.
How many rotatable bond counts does Disperse Red 65 have?
Disperse Red 65 has 6 rotatable bond counts.