What is the molecular formula of Disperse Blue 291?
The molecular formula of Disperse Blue 291 is C19H21BrN6O6.
What is the molecular weight of Disperse Blue 291?
The molecular weight of Disperse Blue 291 is 509.3 g/mol.
What is the IUPAC name of Disperse Blue 291?
The IUPAC name of Disperse Blue 291 is N-[2-[(2-bromo-4,6-dinitrophenyl)diazenyl]-5-(diethylamino)-4-methoxyphenyl]acetamide.
What is the InChI of Disperse Blue 291?
The InChI of Disperse Blue 291 is InChI=1S/C19H21BrN6O6/c1-5-24(6-2)16-9-14(21-11(3)27)15(10-18(16)32-4)22-23-19-13(20)7-12(25(28)29)8-17(19)26(30)31/h7-10H,5-6H2,1-4H3,(H,21,27).
What is the InChIKey of Disperse Blue 291?
The InChIKey of Disperse Blue 291 is QRKGKRSGMAWUMO-UHFFFAOYSA-N.
What is the canonical SMILES of Disperse Blue 291?
The canonical SMILES of Disperse Blue 291 is CCN(CC)C1=C(C=C(C(=C1)NC(=O)C)N=NC2=C(C=C(C=C2Br)[N+](=O)[O-])[N+](=O)[O-])OC.
What is the CAS number of Disperse Blue 291?
The CAS number of Disperse Blue 291 is 56548-64-2.
What is the hydrogen bond donor count of Disperse Blue 291?
The hydrogen bond donor count of Disperse Blue 291 is 1.
What is the hydrogen bond acceptor count of Disperse Blue 291?
The hydrogen bond acceptor count of Disperse Blue 291 is 9.
What is the topological polar surface area of Disperse Blue 291?
The topological polar surface area of Disperse Blue 291 is 158 ?2.