What is the PubChem CID of disodium protoporphyrin ix?
The PubChem CID of disodium protoporphyrin ix is 71484.
What is the molecular formula of disodium protoporphyrin ix?
The molecular formula of disodium protoporphyrin ix is C34H32N4Na2O4.
What are some synonyms of disodium protoporphyrin ix?
Some synonyms of disodium protoporphyrin ix include protoporphyrin disodium, 50865-01-5, Protoporphyrin IX disodium salt, Zinc ionophore II, and Palepron.
What is the molecular weight of disodium protoporphyrin ix?
The molecular weight of disodium protoporphyrin ix is 606.6 g/mol.
What is the IUPAC name of disodium protoporphyrin ix?
The IUPAC name of disodium protoporphyrin ix is disodium;3-[18-(2-carboxylatoethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate.
What is the InChI of disodium protoporphyrin ix?
The InChI of disodium protoporphyrin ix is InChI=1S/C34H34N4O4.2Na/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;;/h7-8,13-16,35-36H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42);;/q;2*+1/p-2.
What is the InChIKey of disodium protoporphyrin ix?
The InChIKey of disodium protoporphyrin ix is GPRXGEKBQVXWAQ-UHFFFAOYSA-L.
What is the Canonical SMILES of disodium protoporphyrin ix?
The Canonical SMILES of disodium protoporphyrin ix is CC1=C(C2=CC3=NC(=CC4=NC(=CC5=C(C(=C(N5)C=C1N2)C=C)C)C(=C4CCC(=O)[O-])C)C(=C3C)CCC(=O)[O-])C=C.[Na+].[Na+].
What is the CAS number of disodium protoporphyrin ix?
The CAS number of disodium protoporphyrin ix is 50865-01-5.
What is the molecular weight of disodium protoporphyrin ix according to PubChem?
The molecular weight of disodium protoporphyrin ix is 606.6 g/mol according to PubChem.
※ Please kindly note that our products are for research use only.