What is the molecular formula of Dipotassium succinate trihydrate?
The molecular formula of Dipotassium succinate trihydrate is C4H10K2O7.
What are the synonyms for Dipotassium succinate trihydrate?
The synonyms for Dipotassium succinate trihydrate are POTASSIUM SUCCINATE TRIHYDRATE, 6100-18-1, Potassiumsuccinatetrihydrate, and Succinic acid potassium salt trihydrate.
What is the molecular weight of Dipotassium succinate trihydrate?
The molecular weight of Dipotassium succinate trihydrate is 248.31 g/mol.
What is the IUPAC name of Dipotassium succinate trihydrate?
The IUPAC name of Dipotassium succinate trihydrate is dipotassium; butanedioate; trihydrate.
What is the InChI of Dipotassium succinate trihydrate?
The InChI of Dipotassium succinate trihydrate is InChI=1S/C4H6O4.2K.3H2O/c5-3(6)1-2-4(7)8;;;;;/h1-2H2,(H,5,6)(H,7,8);;;3*1H2/q;2*+1;;;/p-2.
What is the InChIKey of Dipotassium succinate trihydrate?
The InChIKey of Dipotassium succinate trihydrate is PFTLHQXTAGELAZ-UHFFFAOYSA-L.
What is the canonical SMILES of Dipotassium succinate trihydrate?
The canonical SMILES of Dipotassium succinate trihydrate is C(CC(=O)[O-])C(=O)[O-].O.O.O.[K+].[K+].
What is the CAS number of Dipotassium succinate trihydrate?
The CAS number of Dipotassium succinate trihydrate is 6100-18-1.
What is the UNII of Dipotassium succinate trihydrate?
The UNII of Dipotassium succinate trihydrate is 8B347U4N7P.
What is the hydrogen bond donor count of Dipotassium succinate trihydrate?
The hydrogen bond donor count of Dipotassium succinate trihydrate is 3.
※ Please kindly note that our products are for research use only.