What is the chemical formula of diphenylmethane?
The chemical formula of diphenylmethane is C13H12.
What is the molecular weight of diphenylmethane?
The molecular weight of diphenylmethane is 168.23 g/mol.
What is the IUPAC name of diphenylmethane?
The IUPAC name of diphenylmethane is benzylbenzene.
What is the InChIKey of diphenylmethane?
The InChIKey of diphenylmethane is CZZYITDELCSZES-UHFFFAOYSA-N.
What is the canonical SMILES of diphenylmethane?
The canonical SMILES of diphenylmethane is C1=CC=C(C=C1)CC2=CC=CC=C2.
What is the CAS number of diphenylmethane?
The CAS number of diphenylmethane is 101-81-5.
What is the UNII of diphenylmethane?
The UNII of diphenylmethane is K3E387I0BC.
How many hydrogen bond donor counts does diphenylmethane have?
Diphenylmethane has 0 hydrogen bond donor counts.
How many rotatable bond counts does diphenylmethane have?
Diphenylmethane has 2 rotatable bond counts.
What is the topological polar surface area of diphenylmethane?
The topological polar surface area of diphenylmethane is 0Ų.