What is the PubChem CID for Diphenic anhydride?
PubChem CID 72794
What is the molecular formula of Diphenic anhydride?
The molecular formula is C14H8O3.
What are some synonyms for Diphenic anhydride?
Some synonyms include dibenzo[c,e]oxepine-5,7-dione and Dibenz[c,e]oxepin-5,7-dione.
What is the molecular weight of Diphenic anhydride?
The molecular weight is 224.21 g/mol.
What is the IUPAC Name of Diphenic anhydride?
The IUPAC Name is benzo[d][2]benzoxepine-5,7-dione.
What is the InChI of Diphenic anhydride?
The InChI is InChI=1S/C14H8O3/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(16)17-13/h1-8H.
What is the InChIKey of Diphenic anhydride?
The InChIKey is RTSGJTANVBJFFJ-UHFFFAOYSA-N.
What is the Canonical SMILES of Diphenic anhydride?
The Canonical SMILES is C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)OC2=O.
What is the CAS number of Diphenic anhydride?
The CAS number is 6050-13-1.
Is Diphenic anhydride a canonicalized compound?
Yes, Diphenic anhydride is a canonicalized compound according to PubChem.