What is the molecular formula of Dinonylnaphthalenedisulfonic acid?
The molecular formula of Dinonylnaphthalenedisulfonic acid is C28H44O6S2.
What are the synonyms for Dinonylnaphthalenedisulfonic acid?
The synonyms for Dinonylnaphthalenedisulfonic acid are 2,6-DINONYLNAPHTHALENE-1,5-DISULFONIC ACID and SCHEMBL20803573.
What is the molecular weight of Dinonylnaphthalenedisulfonic acid?
The molecular weight of Dinonylnaphthalenedisulfonic acid is 540.8 g/mol.
What is the IUPAC name of Dinonylnaphthalenedisulfonic acid?
The IUPAC name of Dinonylnaphthalenedisulfonic acid is 2,6-di(nonyl)naphthalene-1,5-disulfonic acid.
What is the InChI of Dinonylnaphthalenedisulfonic acid?
The InChI of Dinonylnaphthalenedisulfonic acid is InChI=1S/C28H44O6S2/c1-3-5-7-9-11-13-15-17-23-19-21-26-25(27(23)35(29,30)31)22-20-24(28(26)36(32,33)34)18-16-14-12-10-8-6-4-2/h19-22H,3-18H2,1-2H3,(H,29,30,31)(H,32,33,34).
What is the InChIKey of Dinonylnaphthalenedisulfonic acid?
The InChIKey of Dinonylnaphthalenedisulfonic acid is KVOYCYJHAKSFSR-UHFFFAOYSA-N.
What is the canonical SMILES representation of Dinonylnaphthalenedisulfonic acid?
The canonical SMILES representation of Dinonylnaphthalenedisulfonic acid is CCCCCCCCCC1=C(C2=C(C=C1)C(=C(C=C2)CCCCCCCCC)S(=O)(=O)O)S(=O)(=O)O.
What is the XLogP3-AA value of Dinonylnaphthalenedisulfonic acid?
The XLogP3-AA value of Dinonylnaphthalenedisulfonic acid is 9.8.
How many hydrogen bond donor counts does Dinonylnaphthalenedisulfonic acid have?
Dinonylnaphthalenedisulfonic acid has 2 hydrogen bond donor counts.
How many rotatable bond counts does Dinonylnaphthalenedisulfonic acid have?
Dinonylnaphthalenedisulfonic acid has 18 rotatable bond counts.
※ Please kindly note that our products are for research use only.