What is the molecular formula of Meptyldinocap?
The molecular formula of Meptyldinocap is C18H24N2O6.
What is the molecular weight of Meptyldinocap?
The molecular weight of Meptyldinocap is 364.4 g/mol.
Is Meptyldinocap soluble in water?
No, Meptyldinocap is nearly insoluble in water.
What is the chemical classification of Meptyldinocap?
Meptyldinocap is classified as a fungicide and acaricide.
What are the synonyms for Meptyldinocap?
The synonyms for Meptyldinocap include Meptyldinocap [ISO], 2,4-DNOPC, and OQU8KLU91P.
What is the IUPAC name of Meptyldinocap?
The IUPAC name of Meptyldinocap is (2,4-dinitro-6-octan-2-ylphenyl) (E)-but-2-enoate.
Can you provide the InChI of Meptyldinocap?
The InChI of Meptyldinocap is InChI=1S/C18H24N2O6/c1-4-6-7-8-10-13(3)15-11-14(19(22)23)12-16(20(24)25)18(15)26-17(21)9-5-2/h5,9,11-13H,4,6-8,10H2,1-3H3/b9-5+.
What are the CAS numbers associated with Meptyldinocap?
The CAS numbers associated with Meptyldinocap are 131-72-6 and 39300-45-3.
Is Meptyldinocap listed in any chemical databases?
Yes, Meptyldinocap is listed in various chemical databases such as CAMEO Chemicals, European Chemicals Agency (ECHA), Hazardous Substances Data Bank (HSDB), and ILO-WHO International Chemical Safety Cards (ICSCs).
Are there any other identifiers or codes for Meptyldinocap?
Yes, Meptyldinocap has other identifiers and codes such as UNII (OQU8KLU91P), DSSTox Substance ID (DTXSID90274056), and Wikidata (Q19296230).