What is the molecular formula of Dimethylaminoborane?
The molecular formula of Dimethylaminoborane is C2H6BN.
What is the molecular weight of Dimethylaminoborane?
The molecular weight of Dimethylaminoborane is 54.89 g/mol.
What is the InChI of Dimethylaminoborane?
The InChI of Dimethylaminoborane is InChI=1S/C2H6BN/c1-4(2)3/h1-2H3.
What is the InChIKey of Dimethylaminoborane?
The InChIKey of Dimethylaminoborane is YPTUAQWMBNZZRN-UHFFFAOYSA-N.
What is the canonical SMILES of Dimethylaminoborane?
The canonical SMILES of Dimethylaminoborane is [B]N(C)C.
What is the CAS number of Dimethylaminoborane?
The CAS number of Dimethylaminoborane is 1838-13-7.
What is the EC number of Dimethylaminoborane?
The EC number of Dimethylaminoborane is 217-411-8.
What is the DSSTox Substance ID of Dimethylaminoborane?
The DSSTox Substance ID of Dimethylaminoborane is DTXSID801315442.
What is the hydrogen bond donor count of Dimethylaminoborane?
The hydrogen bond donor count of Dimethylaminoborane is 0.
Is Dimethylaminoborane a canonicalized compound?
Yes, Dimethylaminoborane is a canonicalized compound.