What is the PubChem CID for Dimethyl suberimidate dihydrochloride?
The PubChem CID for Dimethyl suberimidate dihydrochloride is 118696.
What is the molecular formula of Dimethyl suberimidate dihydrochloride?
The molecular formula of Dimethyl suberimidate dihydrochloride is C10H22Cl2N2O2.
What are the synonyms for Dimethyl suberimidate dihydrochloride?
The synonyms for Dimethyl suberimidate dihydrochloride include dimethyl octanediimidate;dihydrochloride, Octanediimidic acid, dimethyl ester, dihydrochloride, and Dimethyl octanebis(imidate) dihydrochloride.
What is the molecular weight of Dimethyl suberimidate dihydrochloride?
The molecular weight of Dimethyl suberimidate dihydrochloride is 273.20 g/mol.
What is the parent compound of Dimethyl suberimidate dihydrochloride?
The parent compound of Dimethyl suberimidate dihydrochloride is CID 34750 (Dimethyl suberimidate).
What are the component compounds of Dimethyl suberimidate dihydrochloride?
The component compounds of Dimethyl suberimidate dihydrochloride are Hydrochloric Acid (CID 313) and Dimethyl suberimidate (CID 34750).
What is the IUPAC name of Dimethyl suberimidate dihydrochloride?
The IUPAC name of Dimethyl suberimidate dihydrochloride is dimethyl octanediimidate;dihydrochloride.
What is the InChI of Dimethyl suberimidate dihydrochloride?
The InChI of Dimethyl suberimidate dihydrochloride is InChI=1S/C10H20N2O2.2ClH/c1-13-9(11)7-5-3-4-6-8-10(12)14-2;;/h11-12H,3-8H2,1-2H3;2*1H.
What is the InChIKey of Dimethyl suberimidate dihydrochloride?
The InChIKey of Dimethyl suberimidate dihydrochloride is ILKCDNKCNSNFMP-UHFFFAOYSA-N.
What is the CAS number of Dimethyl suberimidate dihydrochloride?
The CAS number of Dimethyl suberimidate dihydrochloride is 34490-86-3.
※ Please kindly note that our products are for research use only.
Download
