What is the PubChem CID of Dihydrobetulin diacetate?
The PubChem CID of Dihydrobetulin diacetate is 236415.
What is the molecular formula of Dihydrobetulin diacetate?
The molecular formula of Dihydrobetulin diacetate is C34H54O4.
What are the synonyms for Dihydrobetulin diacetate?
The synonyms for Dihydrobetulin diacetate include Betulin diacetate, betulin 3,28-diacetate, Betulindiacetate, and Lup-20(29)-ene-3,28-diol diacetate.
What is the molecular weight of Dihydrobetulin diacetate?
The molecular weight of Dihydrobetulin diacetate is 526.8 g/mol.
When was Dihydrobetulin diacetate created and modified?
Dihydrobetulin diacetate was created on March 26, 2005, and last modified on November 25, 2023.
Where is Dihydrobetulin diacetate found?
Dihydrobetulin diacetate is a natural product found in Trichosanthes dioica, Trichosanthes ovigera, and other organisms.
What is the IUPAC name of Dihydrobetulin diacetate?
The IUPAC name of Dihydrobetulin diacetate is [(1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-acetyloxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate.
What is the InChI of Dihydrobetulin diacetate?
The InChI of Dihydrobetulin diacetate is InChI=1S/C34H54O4/c1-21(2)24-12-17-34(20-37-22(3)35)19-18-32(8)25(29(24)34)10-11-27-31(7)15-14-28(38-23(4)36)30(5,6)26(31)13-16-33(27,32)9/h24-29H,1,10-20H2,2-9H3/t24-,25+,26-,27+,28-,29+,31-,32+,33+,34+/m0/s1.
What is the Canonical SMILES of Dihydrobetulin diacetate?
The Canonical SMILES of Dihydrobetulin diacetate is CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)OC(=O)C)C)COC(=O)C.
What is the CAS number of Dihydrobetulin diacetate?
The CAS number of Dihydrobetulin diacetate is 1721-69-3.