What is the molecular formula of Diethylhexyl isophthalate?
The molecular formula of Diethylhexyl isophthalate is C24H38O4.
What are the synonyms for Diethylhexyl isophthalate?
The synonyms for Diethylhexyl isophthalate are Diethylhexyl isophthalate, dioctan-3-yl isophthalate, SCHEMBL9853239, and MFCD00152284.
What is the molecular weight of Diethylhexyl isophthalate?
The molecular weight of Diethylhexyl isophthalate is 390.6 g/mol.
What is the IUPAC name of Diethylhexyl isophthalate?
The IUPAC name of Diethylhexyl isophthalate is dioctan-3-yl benzene-1,3-dicarboxylate.
What is the InChI of Diethylhexyl isophthalate?
The InChI of Diethylhexyl isophthalate is InChI=1S/C24H38O4/c1-5-9-11-16-21(7-3)27-23(25)19-14-13-15-20(18-19)24(26)28-22(8-4)17-12-10-6-2/h13-15,18,21-22H,5-12,16-17H2,1-4H3.
What is the InChIKey of Diethylhexyl isophthalate?
The InChIKey of Diethylhexyl isophthalate is HJRBRVSWKNUUCW-UHFFFAOYSA-N.
What is the canonical SMILES of Diethylhexyl isophthalate?
The canonical SMILES of Diethylhexyl isophthalate is CCCCCC(CC)OC(=O)C1=CC(=CC=C1)C(=O)OC(CC)CCCCC.
What is the XLogP3-AA value of Diethylhexyl isophthalate?
The XLogP3-AA value of Diethylhexyl isophthalate is 8.2.
How many hydrogen bond donor counts does Diethylhexyl isophthalate have?
Diethylhexyl isophthalate has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Diethylhexyl isophthalate have?
Diethylhexyl isophthalate has 4 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.