What is the molecular formula of Diethylhexyl azelate?
The molecular formula of Diethylhexyl azelate is C25H48O4.
What is the molecular weight of Diethylhexyl azelate?
The molecular weight of Diethylhexyl azelate is 412.6 g/mol.
What is the IUPAC name of Diethylhexyl azelate?
The IUPAC name of Diethylhexyl azelate is bis(2-ethylhexyl) nonanedioate.
What is the InChI of Diethylhexyl azelate?
The InChI of Diethylhexyl azelate is InChI=1S/C25H48O4/c1-5-9-16-22(7-3)20-28-24(26)18-14-12-11-13-15-19-25(27)29-21-23(8-4)17-10-6-2/h22-23H,5-21H2,1-4H3.
What is the InChIKey of Diethylhexyl azelate?
The InChIKey of Diethylhexyl azelate is ZDWGXBPVPXVXMQ-UHFFFAOYSA-N.
What is the Canonical SMILES of Diethylhexyl azelate?
The Canonical SMILES of Diethylhexyl azelate is CCCCC(CC)COC(=O)CCCCCCCC(=O)OCC(CC)CCCC.
What is the CAS number of Diethylhexyl azelate?
The CAS number of Diethylhexyl azelate is 103-24-2.
What is the XLogP3-AA value of Diethylhexyl azelate?
The XLogP3-AA value of Diethylhexyl azelate is 8.5.
How many hydrogen bond donor counts does Diethylhexyl azelate have?
Diethylhexyl azelate has 0 hydrogen bond donor counts.
How many rotatable bond counts does Diethylhexyl azelate have?
Diethylhexyl azelate has 22 rotatable bond counts.